C17H23N3O2 — CID 18083745
N-hexyl-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide (PubChem CID 18083745) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-hexyl-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-hexyl-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 18083745 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-hexyl-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxamide |
| SMILES | CCCCCCNC(=O)C1=NN(c2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-3-4-8-13-18-17(22)15-11-12-16(21)20(19-15)14-9-6-5-7-10-14/h5-7,9-10H,2-4,8,11-13H2,1H3,(H,18,22) |
| InChIKey | IPXXNXQBKYCIMD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|