C21H24F3N5O5 — CID 46538816
2,2,2-trifluoroethyl 4-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 46538816) has the molecular formula C21H24F3N5O5 and a molecular weight of 483.45 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46538816 |
| Molecular Formula | C21H24F3N5O5 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)NNC(=O)C2CCN(C(=O)OCC(F)(F)F)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H24F3N5O5/c1-2-9-29-19(32)15-6-4-3-5-14(15)16(27-29)18(31)26-25-17(30)13-7-10-28(11-8-13)20(33)34-12-21(22,23)24/h3-6,13H,2,7-12H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | VEDOJDPALLJOLT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|