C20H19FN4O3S — CID 27551825
N'-[2-(4-fluorophenyl)sulfanylacetyl]-4-oxo-3-propylphthalazine-1-carbohydrazide (PubChem CID 27551825) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)sulfanylacetyl]-4-oxo-3-propylphthalazine-1-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenyl)sulfanylacetyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27551825 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N'-[2-(4-fluorophenyl)sulfanylacetyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)CSc2ccc(F)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H19FN4O3S/c1-2-11-25-20(28)16-6-4-3-5-15(16)18(24-25)19(27)23-22-17(26)12-29-14-9-7-13(21)8-10-14/h3-10H,2,11-12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | LTHQQZYQGRENEE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|