C23H26N4O3 — CID 9428189
N'-[3-(4-ethylphenyl)propanoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide (PubChem CID 9428189) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N'-[3-(4-ethylphenyl)propanoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide.
| Compound Name | N'-[3-(4-ethylphenyl)propanoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 9428189 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N'-[3-(4-ethylphenyl)propanoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)CCc2ccc(CC)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H26N4O3/c1-3-15-27-23(30)19-8-6-5-7-18(19)21(26-27)22(29)25-24-20(28)14-13-17-11-9-16(4-2)10-12-17/h5-12H,3-4,13-15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | IILCNGCWJVQVCN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|