C22H25N5O3 — CID 60599880
4-oxo-3-pentyl-N'-(3-pyridin-2-ylpropanoyl)phthalazine-1-carbohydrazide (PubChem CID 60599880) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N'-(3-pyridin-2-ylpropanoyl)phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-pentyl-N'-(3-pyridin-2-ylpropanoyl)phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 60599880 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-oxo-3-pentyl-N'-(3-pyridin-2-ylpropanoyl)phthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)CCc2ccccn2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H25N5O3/c1-2-3-8-15-27-22(30)18-11-5-4-10-17(18)20(26-27)21(29)25-24-19(28)13-12-16-9-6-7-14-23-16/h4-7,9-11,14H,2-3,8,12-13,15H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | YRJDAVDEYJNUHA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|