C23H24N6O4S — CID 55428038
4-oxo-3-pentyl-N'-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide (PubChem CID 55428038) has the molecular formula C23H24N6O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N'-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-pentyl-N'-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55428038 |
| Molecular Formula | C23H24N6O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 4-oxo-3-pentyl-N'-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)CCc2nc(-c3ccsc3)no2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H24N6O4S/c1-2-3-6-12-29-23(32)17-8-5-4-7-16(17)20(27-29)22(31)26-25-18(30)9-10-19-24-21(28-33-19)15-11-13-34-14-15/h4-5,7-8,11,13-14H,2-3,6,9-10,12H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | FCFLVDHDXRHAFA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|