C21H20N6O4S — CID 35767753
4-oxo-3-propan-2-yl-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide (PubChem CID 35767753) has the molecular formula C21H20N6O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is 4-oxo-3-propan-2-yl-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-propan-2-yl-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 35767753 |
| Molecular Formula | C21H20N6O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 4-oxo-3-propan-2-yl-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]phthalazine-1-carbohydrazide |
| SMILES | CC(C)n1nc(C(=O)NNC(=O)CCc2nc(-c3cccs3)no2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H20N6O4S/c1-12(2)27-21(30)14-7-4-3-6-13(14)18(25-27)20(29)24-23-16(28)9-10-17-22-19(26-31-17)15-8-5-11-32-15/h3-8,11-12H,9-10H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | WDAMMSSRJLDSGG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|