C24H24N6O3S — CID 55438833
4-oxo-3-pentyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]phthalazine-1-carbohydrazide (PubChem CID 55438833) has the molecular formula C24H24N6O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-pentyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55438833 |
| Molecular Formula | C24H24N6O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-oxo-3-pentyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]phthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)Cc2csc(-c3cccnc3)n2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H24N6O3S/c1-2-3-6-12-30-24(33)19-10-5-4-9-18(19)21(29-30)22(32)28-27-20(31)13-17-15-34-23(26-17)16-8-7-11-25-14-16/h4-5,7-11,14-15H,2-3,6,12-13H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | PXDJVVHWJDKIIL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|