C24H25F3N4O4 — CID 26006941
4-oxo-3-pentyl-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl]phthalazine-1-carbohydrazide (PubChem CID 26006941) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl]phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-pentyl-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26006941 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 4-oxo-3-pentyl-N'-[(3S)-4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl]phthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)C[C@](O)(c2ccccc2)C(F)(F)F)c2ccccc2c1=O |
| InChI | InChI=1S/C24H25F3N4O4/c1-2-3-9-14-31-22(34)18-13-8-7-12-17(18)20(30-31)21(33)29-28-19(32)15-23(35,24(25,26)27)16-10-5-4-6-11-16/h4-8,10-13,35H,2-3,9,14-15H2,1H3,(H,28,32)(H,29,33)/t23-/m0/s1 |
| InChIKey | NDHCRTGILDHTJW-QHCPKHFHSA-N |
| XLogP | 3.19 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|