C17H16N4O3S — CID 51205140
2,5-dimethyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]furan-3-carbohydrazide (PubChem CID 51205140) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 51205140 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2,5-dimethyl-N'-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)Cc2csc(-c3cccnc3)n2)c(C)o1 |
| InChI | InChI=1S/C17H16N4O3S/c1-10-6-14(11(2)24-10)16(23)21-20-15(22)7-13-9-25-17(19-13)12-4-3-5-18-8-12/h3-6,8-9H,7H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | VFSQQEXMKGGGOX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|