C16H15N3O4S — CID 31826746
N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 31826746) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 31826746 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)Cc2csc(-c3ccco3)n2)c(C)o1 |
| InChI | InChI=1S/C16H15N3O4S/c1-9-6-12(10(2)23-9)15(21)19-18-14(20)7-11-8-24-16(17-11)13-4-3-5-22-13/h3-6,8H,7H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | IMCIFYWJLDQDPU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|