C21H17N3O3S — CID 32702744
N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2-naphthalen-1-ylacetohydrazide (PubChem CID 32702744) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2-naphthalen-1-ylacetohydrazide.
| Compound Name | N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2-naphthalen-1-ylacetohydrazide |
|---|---|
| PubChem CID | 32702744 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N'-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-2-naphthalen-1-ylacetohydrazide |
| SMILES | O=C(Cc1csc(-c2ccco2)n1)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H17N3O3S/c25-19(11-15-7-3-6-14-5-1-2-8-17(14)15)23-24-20(26)12-16-13-28-21(22-16)18-9-4-10-27-18/h1-10,13H,11-12H2,(H,23,25)(H,24,26) |
| InChIKey | PEWBPPPGGLLLJC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|