C11H17F3N2O3 — CID 60706892
2,2,2-trifluoroethyl 4-(ethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 60706892) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(ethylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-(ethylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60706892 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(ethylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CCNC(=O)C1CCN(C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O3/c1-2-15-9(17)8-3-5-16(6-4-8)10(18)19-7-11(12,13)14/h8H,2-7H2,1H3,(H,15,17) |
| InChIKey | JIBNQKBOGOHBTB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |