C24H27F3N2O3 — CID 46680385
2,2,2-trifluoroethyl 4-(3,3-diphenylpropylcarbamoyl)piperidine-1-carboxylate (PubChem CID 46680385) has the molecular formula C24H27F3N2O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(3,3-diphenylpropylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-(3,3-diphenylpropylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46680385 |
| Molecular Formula | C24H27F3N2O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(3,3-diphenylpropylcarbamoyl)piperidine-1-carboxylate |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)C1CCN(C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C24H27F3N2O3/c25-24(26,27)17-32-23(31)29-15-12-20(13-16-29)22(30)28-14-11-21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,20-21H,11-17H2,(H,28,30) |
| InChIKey | QFAGMNSAOWRELN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |