C23H24N4O3 — CID 35767282
3-ethyl-4-oxo-N'-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]phthalazine-1-carbohydrazide (PubChem CID 35767282) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-ethyl-4-oxo-N'-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]phthalazine-1-carbohydrazide.
| Compound Name | 3-ethyl-4-oxo-N'-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 35767282 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-ethyl-4-oxo-N'-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]phthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)Cc2ccc3c(c2)CCCC3)c2ccccc2c1=O |
| InChI | InChI=1S/C23H24N4O3/c1-2-27-23(30)19-10-6-5-9-18(19)21(26-27)22(29)25-24-20(28)14-15-11-12-16-7-3-4-8-17(16)13-15/h5-6,9-13H,2-4,7-8,14H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | AVRRQITVRYFILC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|