C15H23N4O3S+ — CID 2109384
1-[(2-hydroxybenzoyl)amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 2109384) has the molecular formula C15H23N4O3S+ and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(2-hydroxybenzoyl)amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[(2-hydroxybenzoyl)amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 2109384 |
| Molecular Formula | C15H23N4O3S+ |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-[(2-hydroxybenzoyl)amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | O=C(NNC(=S)NCCC[NH+]1CCOCC1)c1ccccc1O |
| InChI | InChI=1S/C15H22N4O3S/c20-13-5-2-1-4-12(13)14(21)17-18-15(23)16-6-3-7-19-8-10-22-11-9-19/h1-2,4-5,20H,3,6-11H2,(H,17,21)(H2,16,18,23)/p+1 |
| InChIKey | RJFBGXYHRIWCJU-UHFFFAOYSA-O |
| XLogP | -1.19 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|