C19H30N5O2S+ — CID 8659444
1-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 8659444) has the molecular formula C19H30N5O2S+ and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8659444 |
| Molecular Formula | C19H30N5O2S+ |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | O=C(CN1CCCc2ccccc21)NNC(=S)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H29N5O2S/c25-18(15-24-10-3-6-16-5-1-2-7-17(16)24)21-22-19(27)20-8-4-9-23-11-13-26-14-12-23/h1-2,5,7H,3-4,6,8-15H2,(H,21,25)(H2,20,22,27)/p+1 |
| InChIKey | UZGKCARUYFPVCK-UHFFFAOYSA-O |
| XLogP | -0.76 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|