C19H21ClN4OS — CID 8659432
1-(3-chloro-4-methylphenyl)-3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]thiourea (PubChem CID 8659432) has the molecular formula C19H21ClN4OS and a molecular weight of 388.92 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8659432 |
| Molecular Formula | C19H21ClN4OS |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)CN2CCCc3ccccc32)cc1Cl |
| InChI | InChI=1S/C19H21ClN4OS/c1-13-8-9-15(11-16(13)20)21-19(26)23-22-18(25)12-24-10-4-6-14-5-2-3-7-17(14)24/h2-3,5,7-9,11H,4,6,10,12H2,1H3,(H,22,25)(H2,21,23,26) |
| InChIKey | UEHVPHPMEYOWJD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|