C12H17N3O2S2 — CID 7943517
1-[(2-hydroxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 7943517) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-[(2-hydroxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[(2-hydroxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 7943517 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-[(2-hydroxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C12H17N3O2S2/c1-19-8-4-7-13-12(18)15-14-11(17)9-5-2-3-6-10(9)16/h2-3,5-6,16H,4,7-8H2,1H3,(H,14,17)(H2,13,15,18) |
| InChIKey | RYCAKILNWLBGGW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|