C7H15N3O2S2 — CID 7943104
methyl N-(3-methylsulfanylpropylcarbamothioylamino)carbamate (PubChem CID 7943104) has the molecular formula C7H15N3O2S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is methyl N-(3-methylsulfanylpropylcarbamothioylamino)carbamate.
| Compound Name | methyl N-(3-methylsulfanylpropylcarbamothioylamino)carbamate |
|---|---|
| PubChem CID | 7943104 |
| Molecular Formula | C7H15N3O2S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | methyl N-(3-methylsulfanylpropylcarbamothioylamino)carbamate |
| SMILES | COC(=O)NNC(=S)NCCCSC |
| InChI | InChI=1S/C7H15N3O2S2/c1-12-7(11)10-9-6(13)8-4-3-5-14-2/h3-5H2,1-2H3,(H,10,11)(H2,8,9,13) |
| InChIKey | GXEBYQWLWJXDDJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|