C14H28N4S3 — CID 11933372
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-methylsulfanylpropylcarbamothioylamino)thiourea (PubChem CID 11933372) has the molecular formula C14H28N4S3 and a molecular weight of 348.61 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-methylsulfanylpropylcarbamothioylamino)thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-methylsulfanylpropylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 11933372 |
| Molecular Formula | C14H28N4S3 |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-methylsulfanylpropylcarbamothioylamino)thiourea |
| SMILES | CSCCCNC(=S)NNC(=S)N[C@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C14H28N4S3/c1-10-6-4-7-12(11(10)2)16-14(20)18-17-13(19)15-8-5-9-21-3/h10-12H,4-9H2,1-3H3,(H2,15,17,19)(H2,16,18,20)/t10-,11-,12+/m1/s1 |
| InChIKey | NFTVUMBSKLASIA-UTUOFQBUSA-N |
| XLogP | 2.41 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|