C23H38N4O2S — CID 11930420
N-[3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 11930420) has the molecular formula C23H38N4O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is N-[3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 11930420 |
| Molecular Formula | C23H38N4O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | N-[3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H38N4O2S/c1-14-4-3-5-19(15(14)2)25-22(30)27-26-20(28)6-7-24-21(29)23-11-16-8-17(12-23)10-18(9-16)13-23/h14-19H,3-13H2,1-2H3,(H,24,29)(H,26,28)(H2,25,27,30)/t14-,15-,16?,17?,18?,19-,23?/m1/s1 |
| InChIKey | RQMZCZPLEAAVDP-OPXKWTENSA-N |
| XLogP | 3.03 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|