C16H28N2S — CID 124772547
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,2S,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 124772547) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,2S,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,2S,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 124772547 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,2S,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=S)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H28N2S/c1-10-4-3-5-14(11(10)2)17-16(19)18-15-9-12-6-7-13(15)8-12/h10-15H,3-9H2,1-2H3,(H2,17,18,19)/t10-,11+,12+,13+,14+,15+/m1/s1 |
| InChIKey | WMJOPLLKVCSVCU-XZBVAUNFSA-N |
| XLogP | 3.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|