C13H22N2OS — CID 7858471
N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]cyclopropanecarboxamide (PubChem CID 7858471) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]cyclopropanecarboxamide.
| Compound Name | N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 7858471 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]cyclopropanecarboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=S)NC(=O)C1CC1 |
| InChI | InChI=1S/C13H22N2OS/c1-8-4-3-5-11(9(8)2)14-13(17)15-12(16)10-6-7-10/h8-11H,3-7H2,1-2H3,(H2,14,15,16,17)/t8-,9+,11-/m1/s1 |
| InChIKey | YCFWBVBLDUOVMW-WCABBAIRSA-N |
| XLogP | 2.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|