C16H21BrN2OS — CID 7041207
2-bromo-N-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]benzamide (PubChem CID 7041207) has the molecular formula C16H21BrN2OS and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-bromo-N-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 7041207 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-bromo-N-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]benzamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=S)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C16H21BrN2OS/c1-10-6-5-9-14(11(10)2)18-16(21)19-15(20)12-7-3-4-8-13(12)17/h3-4,7-8,10-11,14H,5-6,9H2,1-2H3,(H2,18,19,20,21)/t10-,11+,14+/m0/s1 |
| InChIKey | PVQKVWHUKMQJIS-MISXGVKJSA-N |
| XLogP | 3.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|