C15H20BrN3OS — CID 11899719
5-bromo-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]pyridine-3-carboxamide (PubChem CID 11899719) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is 5-bromo-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11899719 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-bromo-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamothioyl]pyridine-3-carboxamide |
| SMILES | C[C@H]1[C@@H](NC(=S)NC(=O)c2cncc(Br)c2)CCC[C@@H]1C |
| InChI | InChI=1S/C15H20BrN3OS/c1-9-4-3-5-13(10(9)2)18-15(21)19-14(20)11-6-12(16)8-17-7-11/h6-10,13H,3-5H2,1-2H3,(H2,18,19,20,21)/t9-,10+,13-/m0/s1 |
| InChIKey | YHAHWDDJQFCNFB-CWSCBRNRSA-N |
| XLogP | 3.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|