C11H13BrN2O — CID 130552943
5-bromo-N-(2-methylcyclobutyl)pyridine-3-carboxamide (PubChem CID 130552943) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is 5-bromo-N-(2-methylcyclobutyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2-methylcyclobutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 130552943 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-bromo-N-(2-methylcyclobutyl)pyridine-3-carboxamide |
| SMILES | CC1CCC1NC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C11H13BrN2O/c1-7-2-3-10(7)14-11(15)8-4-9(12)6-13-5-8/h4-7,10H,2-3H2,1H3,(H,14,15) |
| InChIKey | KXSNJQQGAYPDFP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |