C15H21BrN2O — CID 1122328
5-bromo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]pyridine-3-carboxamide (PubChem CID 1122328) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-bromo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1122328 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-bromo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1C[C@@H](NC(=O)c2cncc(Br)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21BrN2O/c1-10-4-13(7-15(2,3)6-10)18-14(19)11-5-12(16)9-17-8-11/h5,8-10,13H,4,6-7H2,1-3H3,(H,18,19)/t10-,13-/m1/s1 |
| InChIKey | OAIGEWRXTPQJMC-ZWNOBZJWSA-N |
| XLogP | 3.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |