C17H24BrNO — CID 831549
2-(4-bromophenyl)-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide (PubChem CID 831549) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 831549 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
| SMILES | C[C@H]1C[C@H](NC(=O)Cc2ccc(Br)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24BrNO/c1-12-8-15(11-17(2,3)10-12)19-16(20)9-13-4-6-14(18)7-5-13/h4-7,12,15H,8-11H2,1-3H3,(H,19,20)/t12-,15-/m0/s1 |
| InChIKey | NHSJKBWBXNSWLY-WFASDCNBSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |