C15H22BrNO2S — CID 7028487
4-bromo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzenesulfonamide (PubChem CID 7028487) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is 4-bromo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7028487 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-bromo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzenesulfonamide |
| SMILES | C[C@H]1C[C@H](NS(=O)(=O)c2ccc(Br)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H22BrNO2S/c1-11-8-13(10-15(2,3)9-11)17-20(18,19)14-6-4-12(16)5-7-14/h4-7,11,13,17H,8-10H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | KSNCEBUZVXCWHN-AAEUAGOBSA-N |
| XLogP | 3.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |