C14H20BrNO2S — CID 64741660
4-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide (PubChem CID 64741660) has the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. Its IUPAC name is 4-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64741660 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 4-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(Br)cc2)CC1C |
| InChI | InChI=1S/C14H20BrNO2S/c1-10-3-6-13(9-11(10)2)16-19(17,18)14-7-4-12(15)5-8-14/h4-5,7-8,10-11,13,16H,3,6,9H2,1-2H3 |
| InChIKey | KORMAQSQXIHZTI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |