C14H21BrN2O2S — CID 65206704
5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide (PubChem CID 65206704) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65206704 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2cc(N)ccc2Br)CC1C |
| InChI | InChI=1S/C14H21BrN2O2S/c1-9-3-5-12(7-10(9)2)17-20(18,19)14-8-11(16)4-6-13(14)15/h4,6,8-10,12,17H,3,5,7,16H2,1-2H3 |
| InChIKey | SUCTWSYTRBMWSX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|