C15H21BrN2O — CID 64739491
5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzamide (PubChem CID 64739491) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzamide.
| Compound Name | 5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 64739491 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-amino-2-bromo-N-(3,4-dimethylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2cc(N)ccc2Br)CC1C |
| InChI | InChI=1S/C15H21BrN2O/c1-9-3-5-12(7-10(9)2)18-15(19)13-8-11(17)4-6-14(13)16/h4,6,8-10,12H,3,5,7,17H2,1-2H3,(H,18,19) |
| InChIKey | QOKZCPVRUTVIQV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|