C13H21NO2S2 — CID 769116
N-[(1S,5R)-3,3,5-trimethylcyclohexyl]thiophene-2-sulfonamide (PubChem CID 769116) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[(1S,5R)-3,3,5-trimethylcyclohexyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1S,5R)-3,3,5-trimethylcyclohexyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 769116 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[(1S,5R)-3,3,5-trimethylcyclohexyl]thiophene-2-sulfonamide |
| SMILES | C[C@H]1C[C@H](NS(=O)(=O)c2cccs2)CC(C)(C)C1 |
| InChI | InChI=1S/C13H21NO2S2/c1-10-7-11(9-13(2,3)8-10)14-18(15,16)12-5-4-6-17-12/h4-6,10-11,14H,7-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | JILVXKZYSMHVED-QWRGUYRKSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |