C16H26N2O2S — CID 43749905
N-methyl-2-[(3,3,5-trimethylcyclohexyl)amino]benzenesulfonamide (PubChem CID 43749905) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is N-methyl-2-[(3,3,5-trimethylcyclohexyl)amino]benzenesulfonamide.
| Compound Name | N-methyl-2-[(3,3,5-trimethylcyclohexyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 43749905 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-methyl-2-[(3,3,5-trimethylcyclohexyl)amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1NC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H26N2O2S/c1-12-9-13(11-16(2,3)10-12)18-14-7-5-6-8-15(14)21(19,20)17-4/h5-8,12-13,17-18H,9-11H2,1-4H3 |
| InChIKey | VORLHVLOWQZZCW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |