C24H30N2O5S — CID 159730242
1-amino-9,10-dioxo-4-[(3,3,5-trimethylcyclohexyl)amino]anthracene-2-sulfonic acid;methane (PubChem CID 159730242) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-[(3,3,5-trimethylcyclohexyl)amino]anthracene-2-sulfonic acid;methane.
| Compound Name | 1-amino-9,10-dioxo-4-[(3,3,5-trimethylcyclohexyl)amino]anthracene-2-sulfonic acid;methane |
|---|---|
| PubChem CID | 159730242 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-amino-9,10-dioxo-4-[(3,3,5-trimethylcyclohexyl)amino]anthracene-2-sulfonic acid;methane |
| SMILES | C.CC1CC(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)CC(C)(C)C1 |
| InChI | InChI=1S/C23H26N2O5S.CH4/c1-12-8-13(11-23(2,3)10-12)25-16-9-17(31(28,29)30)20(24)19-18(16)21(26)14-6-4-5-7-15(14)22(19)27;/h4-7,9,12-13,25H,8,10-11,24H2,1-3H3,(H,28,29,30);1H4 |
| InChIKey | NBDMTJFSFWKGJX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|