C22H22N3NaO6S — CID 102269309
sodium N-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]cyclohexyl]ethanimidate (PubChem CID 102269309) has the molecular formula C22H22N3NaO6S and a molecular weight of 479.49 g/mol. Its IUPAC name is sodium N-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]cyclohexyl]ethanimidate.
| Compound Name | sodium N-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]cyclohexyl]ethanimidate |
|---|---|
| PubChem CID | 102269309 |
| Molecular Formula | C22H22N3NaO6S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | sodium N-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]cyclohexyl]ethanimidate |
| SMILES | C/C([O-])=N\C1CCC(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)CC1.[Na+] |
| InChI | InChI=1S/C22H23N3O6S.Na/c1-11(26)24-12-6-8-13(9-7-12)25-16-10-17(32(29,30)31)20(23)19-18(16)21(27)14-4-2-3-5-15(14)22(19)28;/h2-5,10,12-13,25H,6-9,23H2,1H3,(H,24,26)(H,29,30,31);/q;+1/p-1 |
| InChIKey | YFJNHAXGNHFBTF-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|