C23H19N2NaO5S — CID 173019632
sodium;1-amino-4-(3-cyclopropylanilino)-9,10-dioxoanthracene-2-sulfonic acid;hydride (PubChem CID 173019632) has the molecular formula C23H19N2NaO5S and a molecular weight of 458.47 g/mol. Its IUPAC name is sodium;1-amino-4-(3-cyclopropylanilino)-9,10-dioxoanthracene-2-sulfonic acid;hydride.
| Compound Name | sodium;1-amino-4-(3-cyclopropylanilino)-9,10-dioxoanthracene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173019632 |
| Molecular Formula | C23H19N2NaO5S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | sodium;1-amino-4-(3-cyclopropylanilino)-9,10-dioxoanthracene-2-sulfonic acid;hydride |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2cccc(C3CC3)c2)c2c1C(=O)c1ccccc1C2=O.[H-].[Na+] |
| InChI | InChI=1S/C23H18N2O5S.Na.H/c24-21-18(31(28,29)30)11-17(25-14-5-3-4-13(10-14)12-8-9-12)19-20(21)23(27)16-7-2-1-6-15(16)22(19)26;;/h1-7,10-12,25H,8-9,24H2,(H,28,29,30);;/q;+1;-1 |
| InChIKey | CSPDUGLATREJCU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|