C28H25N3O5S — CID 158180763
1-amino-4-[3-(benzylamino)anilino]-9,10-dioxoanthracene-2-sulfonic acid;methane (PubChem CID 158180763) has the molecular formula C28H25N3O5S and a molecular weight of 515.59 g/mol. Its IUPAC name is 1-amino-4-[3-(benzylamino)anilino]-9,10-dioxoanthracene-2-sulfonic acid;methane.
| Compound Name | 1-amino-4-[3-(benzylamino)anilino]-9,10-dioxoanthracene-2-sulfonic acid;methane |
|---|---|
| PubChem CID | 158180763 |
| Molecular Formula | C28H25N3O5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 1-amino-4-[3-(benzylamino)anilino]-9,10-dioxoanthracene-2-sulfonic acid;methane |
| SMILES | C.Nc1c(S(=O)(=O)O)cc(Nc2cccc(NCc3ccccc3)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H21N3O5S.CH4/c28-25-22(36(33,34)35)14-21(23-24(25)27(32)20-12-5-4-11-19(20)26(23)31)30-18-10-6-9-17(13-18)29-15-16-7-2-1-3-8-16;/h1-14,29-30H,15,28H2,(H,33,34,35);1H4 |
| InChIKey | FYOGCYSQBHPELZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|