C21H17N3O8S2 — CID 54435964
1-amino-4-[3-(aminomethyl)anilino]-9,10-dioxoanthracene-2,7-disulfonic acid (PubChem CID 54435964) has the molecular formula C21H17N3O8S2 and a molecular weight of 503.51 g/mol. Its IUPAC name is 1-amino-4-[3-(aminomethyl)anilino]-9,10-dioxoanthracene-2,7-disulfonic acid.
| Compound Name | 1-amino-4-[3-(aminomethyl)anilino]-9,10-dioxoanthracene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 54435964 |
| Molecular Formula | C21H17N3O8S2 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 1-amino-4-[3-(aminomethyl)anilino]-9,10-dioxoanthracene-2,7-disulfonic acid |
| SMILES | NCc1cccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccc(S(=O)(=O)O)cc2C3=O)c1 |
| InChI | InChI=1S/C21H17N3O8S2/c22-9-10-2-1-3-11(6-10)24-15-8-16(34(30,31)32)19(23)18-17(15)20(25)13-5-4-12(33(27,28)29)7-14(13)21(18)26/h1-8,24H,9,22-23H2,(H,27,28,29)(H,30,31,32) |
| InChIKey | WKSWALGZSJCCNU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 206.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|