C27H21N3O5S — CID 15918691
1-amino-4-[4-[(4-aminophenyl)methyl]anilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 15918691) has the molecular formula C27H21N3O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is 1-amino-4-[4-[(4-aminophenyl)methyl]anilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[4-[(4-aminophenyl)methyl]anilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 15918691 |
| Molecular Formula | C27H21N3O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1-amino-4-[4-[(4-aminophenyl)methyl]anilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1ccc(Cc2ccc(Nc3cc(S(=O)(=O)O)c(N)c4c3C(=O)c3ccccc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C27H21N3O5S/c28-17-9-5-15(6-10-17)13-16-7-11-18(12-8-16)30-21-14-22(36(33,34)35)25(29)24-23(21)26(31)19-3-1-2-4-20(19)27(24)32/h1-12,14,30H,13,28-29H2,(H,33,34,35) |
| InChIKey | BQAGPJNWXSERCJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|