C36H26N4O10S2 — CID 71625732
1-amino-4-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-2,5-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 71625732) has the molecular formula C36H26N4O10S2 and a molecular weight of 738.76 g/mol. Its IUPAC name is 1-amino-4-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-2,5-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-2,5-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 71625732 |
| Molecular Formula | C36H26N4O10S2 |
| Molecular Weight | 738.76 g/mol |
| Exact Mass | 738.11 |
| IUPAC Name | 1-amino-4-[4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-2,5-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Cc1cc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c(C)cc1Nc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C36H26N4O10S2/c1-15-11-22(40-24-14-26(52(48,49)50)32(38)30-28(24)34(42)18-8-4-6-10-20(18)36(30)44)16(2)12-21(15)39-23-13-25(51(45,46)47)31(37)29-27(23)33(41)17-7-3-5-9-19(17)35(29)43/h3-14,39-40H,37-38H2,1-2H3,(H,45,46,47)(H,48,49,50) |
| InChIKey | PZFYMTRZIJQPQA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 253.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|