C21H16N2O8S2 — CID 54241817
5-amino-8-(2-methylanilino)-9,10-dioxoanthracene-1,6-disulfonic acid (PubChem CID 54241817) has the molecular formula C21H16N2O8S2 and a molecular weight of 488.50 g/mol. Its IUPAC name is 5-amino-8-(2-methylanilino)-9,10-dioxoanthracene-1,6-disulfonic acid.
| Compound Name | 5-amino-8-(2-methylanilino)-9,10-dioxoanthracene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 54241817 |
| Molecular Formula | C21H16N2O8S2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 5-amino-8-(2-methylanilino)-9,10-dioxoanthracene-1,6-disulfonic acid |
| SMILES | Cc1ccccc1Nc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1c(cccc1S(=O)(=O)O)C2=O |
| InChI | InChI=1S/C21H16N2O8S2/c1-10-5-2-3-7-12(10)23-13-9-15(33(29,30)31)19(22)18-17(13)21(25)16-11(20(18)24)6-4-8-14(16)32(26,27)28/h2-9,23H,22H2,1H3,(H,26,27,28)(H,29,30,31) |
| InChIKey | ORAVAIXWZJTNBV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|