C21H15N3O10S2 — CID 19091638
2-amino-5-[(4-amino-9,10-dioxo-3,8-disulfoanthracen-1-yl)amino]benzoic acid (PubChem CID 19091638) has the molecular formula C21H15N3O10S2 and a molecular weight of 533.50 g/mol. Its IUPAC name is 2-amino-5-[(4-amino-9,10-dioxo-3,8-disulfoanthracen-1-yl)amino]benzoic acid.
| Compound Name | 2-amino-5-[(4-amino-9,10-dioxo-3,8-disulfoanthracen-1-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 19091638 |
| Molecular Formula | C21H15N3O10S2 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | 2-amino-5-[(4-amino-9,10-dioxo-3,8-disulfoanthracen-1-yl)amino]benzoic acid |
| SMILES | Nc1ccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2c(cccc2S(=O)(=O)O)C3=O)cc1C(=O)O |
| InChI | InChI=1S/C21H15N3O10S2/c22-11-5-4-8(6-10(11)21(27)28)24-12-7-14(36(32,33)34)18(23)17-16(12)20(26)15-9(19(17)25)2-1-3-13(15)35(29,30)31/h1-7,24H,22-23H2,(H,27,28)(H,29,30,31)(H,32,33,34) |
| InChIKey | SKQMUKIJPUOECT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 244.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|