C21H14N2O7S — CID 25114303
4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]benzoic acid (PubChem CID 25114303) has the molecular formula C21H14N2O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is 4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]benzoic acid.
| Compound Name | 4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 25114303 |
| Molecular Formula | C21H14N2O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 4-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]benzoic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(C(=O)O)cc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H14N2O7S/c22-18-15(31(28,29)30)9-14(23-11-7-5-10(6-8-11)21(26)27)16-17(18)20(25)13-4-2-1-3-12(13)19(16)24/h1-9,23H,22H2,(H,26,27)(H,28,29,30) |
| InChIKey | QNQAEGCXDAVKAX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|