C20H13BrN2O5S — CID 25124161
1-amino-4-(3-bromoanilino)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 25124161) has the molecular formula C20H13BrN2O5S and a molecular weight of 473.30 g/mol. Its IUPAC name is 1-amino-4-(3-bromoanilino)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-(3-bromoanilino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 25124161 |
| Molecular Formula | C20H13BrN2O5S |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 1-amino-4-(3-bromoanilino)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2cccc(Br)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H13BrN2O5S/c21-10-4-3-5-11(8-10)23-14-9-15(29(26,27)28)18(22)17-16(14)19(24)12-6-1-2-7-13(12)20(17)25/h1-9,23H,22H2,(H,26,27,28) |
| InChIKey | HTYPARFZJKMPJI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|