C24H15F2N5O5S — CID 54479037
1-amino-4-[3-[(5,6-difluoropyrimidin-4-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 54479037) has the molecular formula C24H15F2N5O5S and a molecular weight of 523.48 g/mol. Its IUPAC name is 1-amino-4-[3-[(5,6-difluoropyrimidin-4-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[3-[(5,6-difluoropyrimidin-4-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 54479037 |
| Molecular Formula | C24H15F2N5O5S |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 1-amino-4-[3-[(5,6-difluoropyrimidin-4-yl)amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2cccc(Nc3ncnc(F)c3F)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H15F2N5O5S/c25-19-23(26)28-10-29-24(19)31-12-5-3-4-11(8-12)30-15-9-16(37(34,35)36)20(27)18-17(15)21(32)13-6-1-2-7-14(13)22(18)33/h1-10,30H,27H2,(H,28,29,31)(H,34,35,36) |
| InChIKey | XNRGHUXGNLCRPB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|