C23H20N2O6S — CID 56944237
1-amino-9,10-dioxo-4-(3-propan-2-yloxyanilino)anthracene-2-sulfonic acid (PubChem CID 56944237) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-(3-propan-2-yloxyanilino)anthracene-2-sulfonic acid.
| Compound Name | 1-amino-9,10-dioxo-4-(3-propan-2-yloxyanilino)anthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 56944237 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-amino-9,10-dioxo-4-(3-propan-2-yloxyanilino)anthracene-2-sulfonic acid |
| SMILES | CC(C)Oc1cccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C23H20N2O6S/c1-12(2)31-14-7-5-6-13(10-14)25-17-11-18(32(28,29)30)21(24)20-19(17)22(26)15-8-3-4-9-16(15)23(20)27/h3-12,25H,24H2,1-2H3,(H,28,29,30) |
| InChIKey | WUYKXCVEYSIFLT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|