About CID 71308378
CID 71308378 (PubChem CID 71308378) has the molecular formula C22H16N2NaO7S2
and a molecular weight of 507.50 g/mol.
Molecular Properties
| Compound Name | CID 71308378 |
| PubChem CID | 71308378 |
| Molecular Formula | C22H16N2NaO7S2 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | — |
| SMILES | C=CS(=O)(=O)c1cccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1.[Na] |
| InChI | InChI=1S/C22H16N2O7S2.Na/c1-2-32(27,28)13-7-5-6-12(10-13)24-16-11-17(33(29,30)31)20(23)19-18(16)21(25)14-8-3-4-9-15(14)22(19)26;/h2-11,24H,1,23H2,(H,29,30,31); |
| InChIKey | YBKLUTQGHNVYTN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 160.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 71308378 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71308378?
The IUPAC name of CID 71308378 (CID 71308378) is not available.
What is the SMILES notation for CID 71308378?
The canonical SMILES for CID 71308378 is C=CS(=O)(=O)c1cccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1.[Na].
What is the InChIKey of CID 71308378?
The InChIKey is YBKLUTQGHNVYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O7S2.Na/c1-2-32(27,28)13-7-5-6-12(10-13)24-16-11-17(33(29,30)31)20(23)19-18(16)21(25)14-8-3-4-9-15(14)22(19)26;/h2-11,24H,1,23H2,(H,29,30,31);.
What are the key properties of CID 71308378?
CID 71308378 has a molecular weight of 507.50 g/mol, XLogP of 2.57, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71308378 is sourced from PubChem (CID 71308378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).