C22H16N2NaO7S2 — CID 71308378
CID 71308378 (PubChem CID 71308378) has the molecular formula C22H16N2NaO7S2 and a molecular weight of 507.50 g/mol.
| Compound Name | CID 71308378 |
|---|---|
| PubChem CID | 71308378 |
| Molecular Formula | C22H16N2NaO7S2 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | — |
| SMILES | C=CS(=O)(=O)c1cccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1.[Na] |
| InChI | InChI=1S/C22H16N2O7S2.Na/c1-2-32(27,28)13-7-5-6-12(10-13)24-16-11-17(33(29,30)31)20(23)19-18(16)21(25)14-8-3-4-9-15(14)22(19)26;/h2-11,24H,1,23H2,(H,29,30,31); |
| InChIKey | YBKLUTQGHNVYTN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 160.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|