C29H18Cl2N8O11S3 — CID 6337298
5-amino-8-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]diazenyl]anilino]-9,10-dioxoanthracene-1,6-disulfonic acid (PubChem CID 6337298) has the molecular formula C29H18Cl2N8O11S3 and a molecular weight of 821.61 g/mol. Its IUPAC name is 5-amino-8-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]diazenyl]anilino]-9,10-dioxoanthracene-1,6-disulfonic acid.
| Compound Name | 5-amino-8-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]diazenyl]anilino]-9,10-dioxoanthracene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 6337298 |
| Molecular Formula | C29H18Cl2N8O11S3 |
| Molecular Weight | 821.61 g/mol |
| Exact Mass | 819.96 |
| IUPAC Name | 5-amino-8-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]diazenyl]anilino]-9,10-dioxoanthracene-1,6-disulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(/N=N/c3ccc(Nc4nc(Cl)nc(Cl)n4)cc3S(=O)(=O)O)cc2)c2c1C(=O)c1cccc(S(=O)(=O)O)c1C2=O |
| InChI | InChI=1S/C29H18Cl2N8O11S3/c30-27-35-28(31)37-29(36-27)34-14-8-9-16(19(10-14)52(45,46)47)39-38-13-6-4-12(5-7-13)33-17-11-20(53(48,49)50)24(32)23-22(17)26(41)21-15(25(23)40)2-1-3-18(21)51(42,43)44/h1-11,33H,32H2,(H,42,43,44)(H,45,46,47)(H,48,49,50)(H,34,35,36,37)/b39-38+ |
| InChIKey | OMZQIIHBHRKEEK-YMZYAJTMSA-N |
| XLogP | 5.18 |
| TPSA | 310.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|